CAS 85430-60-0
:3-nitro-1,3-oxazolidin-2-one
Description:
3-Nitro-1,3-oxazolidin-2-one is a heterocyclic organic compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of a nitro group at the 3-position contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the oxazolidinone moiety. Its molecular structure suggests that it may participate in nucleophilic substitution reactions, making it of interest in synthetic organic chemistry. Additionally, the nitro group can serve as a handle for further functionalization, allowing for the development of more complex molecules. The compound's CAS number, 85430-60-0, is a unique identifier that facilitates its identification in chemical databases. Overall, 3-nitro-1,3-oxazolidin-2-one is a valuable compound in the realm of medicinal chemistry and materials science, with potential applications in drug development and synthesis.
Formula:C3H4N2O4
InChI:InChI=1/C3H4N2O4/c6-3-4(5(7)8)1-2-9-3/h1-2H2
SMILES:C1COC(=O)N1N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
