CAS 85431-07-8
:Ethyl 4-(4-hydroxybutyl)benzoate
Description:
Ethyl 4-(4-hydroxybutyl)benzoate, with the CAS number 85431-07-8, is an organic compound that belongs to the class of benzoates. It features an ethyl ester functional group and a hydroxybutyl substituent on the aromatic ring, which contributes to its unique properties. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature due to the aromatic structure. Ethyl 4-(4-hydroxybutyl)benzoate may exhibit biological activity, making it of interest in various applications, including pharmaceuticals and cosmetics. Its structure suggests potential for hydrogen bonding due to the hydroxyl group, which can influence its reactivity and interactions with other molecules. Additionally, the presence of both hydrophilic and hydrophobic regions in its molecular structure may allow it to act as an emulsifier or surfactant in formulations. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in practical applications.
Formula:C13H18O3
InChI:InChI=1S/C13H18O3/c1-2-16-13(15)12-8-6-11(7-9-12)5-3-4-10-14/h6-9,14H,2-5,10H2,1H3
InChI key:InChIKey=DEAHZHUWDRVSBC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=C(CCCCO)C=C1
Synonyms:- Benzoic acid, 4-(4-hydroxybutyl)-, ethyl ester
- Ethyl 4-(4-hydroxybutyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
