CAS 854357-37-2

2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)thio]acetic acid

Description:

2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)thio]acetic acid, with the CAS number 854357-37-2, is a chemical compound characterized by its unique structure that includes a benzisothiazole moiety and a thioether functional group. This compound typically exhibits properties associated with both acidic and thioether functionalities, making it potentially useful in various chemical applications. The presence of the dioxido group suggests that it may have oxidizing properties, while the thioether linkage can impart stability and influence reactivity. In terms of solubility, compounds of this nature are often soluble in polar solvents due to the presence of the carboxylic acid group. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and the presence of other reactants. Overall, this compound represents a class of thioacetic acids that may have diverse applications in organic synthesis and medicinal chemistry.

Formula: C₉H₇NO₄S₂

InChI: InChI=1S/C9H7NO4S2/c11-8(12)5-15-9-6-3-1-2-4-7(6)16(13,14)10-9/h1-4H,5H2,(H,11,12)

InChI key: InChIKey=LYHWDWXFGPHJOQ-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C=1C=2C(S(=O)(=O)N1)=CC=CC2

Synonyms:

• Acetic acid, 2-[(1,1-dioxido-1,2-benzisothiazol-3-yl)thio]-
• 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)thio]acetic acid

2-[(1,1-Dioxo-1,2-benzothiazol-3-yl)sulfanyl]acetic acid

CAS: 854357-37-2

Versatile small molecule scaffold

Formula: C₉H₇NO₄S₂

Purity: Min. 95%

Molecular weight: 257.3 g/mol

Ref: 3D-EJB35737