CAS 854357-43-0
:N-[2-[(2-Amino-2-oxoethyl)thio]phenyl]-2-chloroacetamide
Description:
N-[2-[(2-Amino-2-oxoethyl)thio]phenyl]-2-chloroacetamide, identified by its CAS number 854357-43-0, is a chemical compound that features a chloroacetamide functional group and a thioether linkage. This compound is characterized by its potential biological activity, often explored in pharmaceutical research for its possible applications in drug development. The presence of the amino and carbonyl groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and acylation. Its thioether moiety can enhance lipophilicity, potentially influencing its pharmacokinetic properties. The chloroacetamide group may also contribute to its reactivity, making it a candidate for further modification or conjugation in synthetic pathways. Overall, this compound's unique structural features position it as a subject of interest in medicinal chemistry, particularly in the context of developing new therapeutic agents. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H11ClN2O2S
InChI:InChI=1S/C10H11ClN2O2S/c11-5-10(15)13-7-3-1-2-4-8(7)16-6-9(12)14/h1-4H,5-6H2,(H2,12,14)(H,13,15)
InChI key:InChIKey=QJZCVYHCPSONIO-UHFFFAOYSA-N
SMILES:S(CC(N)=O)C1=C(NC(CCl)=O)C=CC=C1
Synonyms:- Acetamide, N-[2-[(2-amino-2-oxoethyl)thio]phenyl]-2-chloro-
- N-[2-[(2-Amino-2-oxoethyl)thio]phenyl]-2-chloroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.