CAS 854357-46-3

5-[(Diethylamino)sulfonyl]-2-(4-methyl-1-piperidinyl)benzoic acid

Description:

5-[(Diethylamino)sulfonyl]-2-(4-methyl-1-piperidinyl)benzoic acid, with the CAS number 854357-46-3, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a diethylamino sulfonyl group and a piperidine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of both hydrophobic and hydrophilic functional groups. The diethylamino group contributes to its basicity, while the sulfonyl group can enhance its reactivity and interaction with biological targets. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its unique structural features suggest potential applications in medicinal chemistry, where modifications can lead to variations in biological activity and pharmacokinetics. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with certain functional groups.

Formula: C₁₇H₂₆N₂O₄S

InChI: InChI=1S/C17H26N2O4S/c1-4-19(5-2)24(22,23)14-6-7-16(15(12-14)17(20)21)18-10-8-13(3)9-11-18/h6-7,12-13H,4-5,8-11H2,1-3H3,(H,20,21)

InChI key: InChIKey=ONVBYGSYSFIRRP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(S(N(CC)CC)(=O)=O)=C1)N2CCC(C)CC2

Synonyms:

• 5-[(Diethylamino)sulfonyl]-2-(4-methyl-1-piperidinyl)benzoic acid
• Benzoic acid, 5-[(diethylamino)sulfonyl]-2-(4-methyl-1-piperidinyl)-