CAS 854357-48-5

3-[4-(Cyanomethoxy)phenyl]-2-propenoic acid

Description:

3-[4-(Cyanomethoxy)phenyl]-2-propenoic acid, with the CAS number 854357-48-5, is an organic compound characterized by its propenoic acid structure, which features a double bond between the second and third carbon atoms of the propene chain. The presence of a cyanomethoxy group attached to a phenyl ring significantly influences its chemical properties, including its reactivity and solubility. This compound is likely to exhibit both acidic and nucleophilic characteristics due to the carboxylic acid functional group and the electron-withdrawing cyanomethoxy substituent. It may participate in various chemical reactions, such as esterification and Michael addition, making it of interest in organic synthesis and medicinal chemistry. Additionally, its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as the cyanomethoxy group may impart toxicity or reactivity under certain conditions.

Formula: C₁₁H₉NO₃

InChI: InChI=1S/C11H9NO3/c12-7-8-15-10-4-1-9(2-5-10)3-6-11(13)14/h1-6H,8H2,(H,13,14)

InChI key: InChIKey=QQNDRZWCSPILDT-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=CC=C(OCC#N)C=C1

Synonyms:

• 3-[4-(Cyanomethoxy)phenyl]-2-propenoic acid
• 2-Propenoic acid, 3-[4-(cyanomethoxy)phenyl]-