CAS 854357-49-6
:2-(1-Chloroethyl)-5-(2-thienyl)-1,3,4-oxadiazole
Description:
2-(1-Chloroethyl)-5-(2-thienyl)-1,3,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a chloroethyl group that enhances its reactivity and a thienyl substituent that contributes to its aromatic properties. The presence of the thienyl group can influence the compound's electronic properties, potentially making it useful in various applications, including pharmaceuticals and agrochemicals. The oxadiazole moiety is known for its biological activity, often exhibiting antimicrobial, antifungal, or anti-inflammatory properties. Additionally, the chlorine atom in the chloroethyl group can serve as a leaving group in chemical reactions, facilitating further functionalization. The compound's solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Overall, 2-(1-Chloroethyl)-5-(2-thienyl)-1,3,4-oxadiazole represents a versatile structure in organic synthesis and medicinal chemistry, with potential applications in developing new therapeutic agents.
Formula:C8H7ClN2OS
InChI:InChI=1S/C8H7ClN2OS/c1-5(9)7-10-11-8(12-7)6-3-2-4-13-6/h2-5H,1H3
InChI key:InChIKey=NJHQJNCNBUTPBF-UHFFFAOYSA-N
SMILES:C(C)(Cl)C=1OC(=NN1)C2=CC=CS2
Synonyms:- 1,3,4-Oxadiazole, 2-(1-chloroethyl)-5-(2-thienyl)-
- 2-(1-Chloroethyl)-5-(2-thienyl)-1,3,4-oxadiazole
- 2-(1-Chloroethyl)-5-(thiophen-2-yl)-1,3,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.