CAS 85438-96-6
:5-Acetylamino-6-formylamino-3-methyluracil
Description:
5-Acetylamino-6-formylamino-3-methyluracil, identified by its CAS number 85438-96-6, is a synthetic organic compound that belongs to the class of uracil derivatives. This substance features a uracil core structure, which is a pyrimidine nucleobase, modified with acetyl and formyl amino groups at specific positions. The presence of these functional groups contributes to its potential biological activity, particularly in the context of nucleic acid interactions and enzyme inhibition. The compound is typically characterized by its solubility in polar solvents, reflecting the influence of its functional groups on its chemical behavior. Additionally, it may exhibit properties such as UV absorbance due to the conjugated system inherent in its structure. The compound's synthesis and characterization are of interest in medicinal chemistry, particularly for its potential applications in drug development and as a biochemical probe. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for biological activity and reactivity.
Formula:C8H10N4O4
InChI:InChI=1S/C8H10N4O4/c1-4(14)10-5-6(9-3-13)11-8(16)12(2)7(5)15/h3H,1-2H3,(H,9,13)(H,10,14)(H,11,16)
InChI key:InChIKey=RDZNZFGKEVDNPK-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(NC=O)NC(=O)N(C)C1=O
Synonyms:- 5-Acetylamino-6-formylamino-3-methyluracil
- N-[4-(Formylamino)-1,2,3,6-tetrahydro-1-methyl-2,6-dioxo-5-pyrimidinyl]acetamide
- Acetamide, N-[4-(formylamino)-1,2,3,6-tetrahydro-1-methyl-2,6-dioxo-5-pyrimidinyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Acetylamino-6-formylamino-3-methyluracil
CAS:Controlled ProductApplications Metabolite of Caffeine (C080100).
References Grant, D.M., et al.: Clin. Pharm. and Ther., 33, 591 (1983),Formula:C8H10N4O4Color and Shape:Light Yellow SolidMolecular weight:226.195-Acetylamino-6-formylamino-3-methyluracil
CAS:5-Acetylamino-6-formylamino-3-methyluracil is an analysis method that can be used to determine the effectiveness of certain contraceptives. This drug has shown a potential to interact with other drugs, such as caffeine and amphetamines. It is also used to measure the enzyme activities of polymorphic human erythrocytes. 5-Acetylamino-6-formylamino-3-methyluracil is used in the preparation of blood samples for DNA sequencing and polymerase chain reaction (PCR) amplification. The concentration of intracellular calcium ions in humans has been shown to increase when this drug is administered, which leads to hyperproliferative diseases like cancer or HIV infection.Formula:C8H10N4O4Purity:(%) Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:226.19 g/mol


