CymitQuimica logo

CAS 85440-78-4

:

3,3-Dimethylbicyclo[2.2.1]heptane-2-carbonyl chloride

Description:
3,3-Dimethylbicyclo[2.2.1]heptane-2-carbonyl chloride, with the CAS number 85440-78-4, is a chemical compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework with two methyl groups at the 3-position and a carbonyl chloride functional group at the 2-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the carbonyl chloride group, which can participate in nucleophilic acyl substitution reactions, making it useful in organic synthesis. The bicyclic structure contributes to its unique steric and electronic properties, influencing its reactivity and interactions with other chemical species. Additionally, it may exhibit moderate to high volatility and can be sensitive to moisture, requiring careful handling and storage conditions. As with many carbonyl compounds, it may pose health hazards, necessitating appropriate safety measures during use.
Formula:C10H15ClO
InChI:InChI=1S/C10H15ClO/c1-10(2)7-4-3-6(5-7)8(10)9(11)12/h6-8H,3-5H2,1-2H3
InChI key:InChIKey=MMJZYLSOVDKRTC-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1C2CC(C1(C)C)CC2
Synonyms:
  • 3,3-Dimethylbicyclo[2.2.1]heptane-2-carbonyl chloride
  • Bicyclo[2.2.1]heptane-2-carbonyl chloride, 3,3-dimethyl-
  • Camphenilyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.