CAS 854403-53-5
:4-Bromo-3-methyl-6-(1-methylethyl)-1,2-benzenediamine
Description:
4-Bromo-3-methyl-6-(1-methylethyl)-1,2-benzenediamine, with the CAS number 854403-53-5, is an organic compound characterized by its aromatic structure and the presence of multiple functional groups. This compound features a bromine atom and an isopropyl group attached to a benzene ring, along with two amine groups (-NH2) at the 1 and 2 positions of the ring. The presence of the bromine substituent contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The amine groups can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety and handling precautions are essential due to the presence of bromine and amine groups, which can pose health risks if not managed properly.
Formula:C10H15BrN2
InChI:InChI=1S/C10H15BrN2/c1-5(2)7-4-8(11)6(3)9(12)10(7)13/h4-5H,12-13H2,1-3H3
InChI key:InChIKey=HLZWVFOVPPQWET-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(N)C(N)=C(C)C(Br)=C1
Synonyms:- 1,2-Benzenediamine, 4-bromo-3-methyl-6-(1-methylethyl)-
- 2,3-p-Cymenediamine, 6-bromo-
- 4-Bromo-3-methyl-6-(1-methylethyl)-1,2-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
