CAS 854515-01-8

6-Methoxy-2-methylbenzo[b]thiophene-3-carboxylic acid

Description:

6-Methoxy-2-methylbenzo[b]thiophene-3-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene core, a methoxy group, and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The presence of the methoxy group can influence its solubility and reactivity, often enhancing its lipophilicity. The carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, affecting its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its potential biological activity, as derivatives of thiophene and benzo[b]thiophene are known for various pharmacological properties. Additionally, its structural features may allow for further functionalization, making it a versatile building block in organic synthesis. Overall, 6-Methoxy-2-methylbenzo[b]thiophene-3-carboxylic acid represents a compound with significant potential for research and application in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₁₀O₃S

InChI: InChI=1S/C11H10O3S/c1-6-10(11(12)13)8-4-3-7(14-2)5-9(8)15-6/h3-5H,1-2H3,(H,12,13)

InChI key: InChIKey=QOWXSQNFVNTGQJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(SC1C)=CC(OC)=CC2

Synonyms:

• 6-Methoxy-2-methyl-1-benzothiophene-3-carboxylic acid
• 6-Methoxy-2-methylbenzo[b]thiophene-3-carboxylic acid
• Benzo[b]thiophene-3-carboxylic acid, 6-methoxy-2-methyl-

6-Methoxy-2-methylbenzo[b]thiophene-3-carboxylic acid

CAS: 854515-01-8

6-Methoxy-2-methylbenzo[b]thiophene-3-carboxylic acid

Purity: 97%

Molecular weight: 222.26g/mol

Ref: 54-OR1057642