
CAS 854519-98-5
:4,5-Difluoro-1,2-benzenedicarboxaldehyde
Description:
4,5-Difluoro-1,2-benzenedicarboxaldehyde is an organic compound characterized by the presence of two aldehyde functional groups and two fluorine substituents on a benzene ring. Its molecular structure features a benzene ring with carboxaldehyde groups (-CHO) at the 1 and 2 positions, and fluorine atoms at the 4 and 5 positions, which significantly influence its chemical reactivity and physical properties. This compound is typically a pale yellow solid at room temperature and is soluble in organic solvents. The presence of fluorine atoms enhances its electron-withdrawing properties, which can affect its reactivity in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound may exhibit interesting optical properties due to the presence of the aldehyde groups and the fluorine substituents. It is important in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as with many fluorinated organic compounds, due to potential toxicity and environmental concerns.
Formula:C8H4F2O2
InChI:InChI=1S/C8H4F2O2/c9-7-1-5(3-11)6(4-12)2-8(7)10/h1-4H
InChI key:InChIKey=VKRQVPHHVPUVCV-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=O)C=C(F)C(F)=C1
Synonyms:- 1,2-Benzenedicarboxaldehyde, 4,5-difluoro-
- 4,5-Difluoro-1,2-benzenedicarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.