CAS 854692-50-5
:3-(3,5-dimethylphenyl)-1-phenyl-propan-1-one
Description:
3-(3,5-Dimethylphenyl)-1-phenyl-propan-1-one, also known by its CAS number 854692-50-5, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents: a 3,5-dimethylphenyl group and a phenyl group. This compound is characterized by its relatively high molecular weight and the presence of multiple aromatic rings, which contribute to its stability and potential reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the ketone functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions. Additionally, due to its structural features, it may possess interesting optical and electronic properties, making it of interest in fields such as materials science and organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-10-14(2)12-15(11-13)8-9-17(18)16-6-4-3-5-7-16/h3-7,10-12H,8-9H2,1-2H3
SMILES:Cc1cc(C)cc(CCC(=O)c2ccccc2)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.