CAS 854738-04-8

3-Heptadecyl-1H-1,2,4-triazol-5-amine

Description:

3-Heptadecyl-1H-1,2,4-triazol-5-amine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a long hydrophobic heptadecyl chain, contributing to its amphiphilic nature, which can influence its solubility and interaction with biological membranes. The presence of an amine functional group suggests potential for hydrogen bonding, making it relevant in various chemical and biological applications. Its structure may impart specific properties such as antimicrobial or antifungal activity, which are common in triazole derivatives. The compound's molecular weight, melting point, and solubility characteristics would depend on the specific arrangement of atoms and the length of the alkyl chain. As with many triazole compounds, it may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₉H₃₈N₄

InChI: InChI=1S/C19H38N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)23-22-18/h2-17H2,1H3,(H3,20,21,22,23)

InChI key: InChIKey=QQGWGESQLZHLOI-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCCCCCCCC)C1=NN=C(N)N1

Synonyms:

• 1H-1,2,4-Triazol-5-amine, 3-heptadecyl-
• s-Triazole, 3-amino-5-heptadecyl-
• 5-(Heptadecan-1-yl)-1,2,4-triazol-3-amine
• 3-Heptadecyl-1H-1,2,4-triazol-5-amine