CymitQuimica logo

CAS 854738-30-0

:

1-(4-nitrophenyl)-5-oxo-2,5-dihydro-1H-1,2,4-triazole-3-carboxylic acid

Description:
1-(4-Nitrophenyl)-5-oxo-2,5-dihydro-1H-1,2,4-triazole-3-carboxylic acid is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a nitrophenyl group indicates that it has a nitro substituent on a phenyl ring, which can influence its electronic properties and reactivity. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the triazole ring may impart some stability against hydrolysis. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of bioactive compounds. Additionally, the presence of the nitro group may enhance its biological activity or serve as a handle for further chemical modifications. Overall, this compound's characteristics make it of interest in various fields of chemical research and development.
Formula:C9H6N4O5
InChI:InChI=1/C9H6N4O5/c14-8(15)7-10-9(16)12(11-7)5-1-3-6(4-2-5)13(17)18/h1-4H,(H,14,15)(H,10,11,16)
Synonyms:
  • 1H-1,2,4-Triazole-3-carboxylic acid, 4,5-dihydro-1-(4-nitrophenyl)-5-oxo-
  • 1-(4-Nitrophenyl)-5-oxo-4,5-dihydro-1H-1,2,4-triazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.