CAS 854753-78-9
:α-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethyl]-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]poly(oxy-1,2-ethanediyl)
Description:
The chemical substance identified by the name "α-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethyl]-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]poly(oxy-1,2-ethanediyl)" and CAS number 854753-78-9 is a complex organic compound characterized by its polyether structure, which includes multiple ethylene oxide units. This compound features functional groups such as amines and carbonyls, contributing to its potential reactivity and biological activity. The presence of the pyrrole derivative suggests it may exhibit unique pharmacological properties, possibly related to its interactions with biological systems. The poly(oxy-1,2-ethanediyl) moiety indicates that it may possess surfactant-like properties, which could enhance its solubility and stability in various formulations. Overall, this substance may be of interest in pharmaceutical or biochemical applications, particularly in drug delivery systems or as a potential therapeutic agent, although specific biological activities and safety profiles would require further investigation.
Formula:C38H62N4O17
InChI:InChI=1S/C20H26N4O8/c25-15(5-9-23-17(27)1-2-18(23)28)21-7-11-31-13-14-32-12-8-22-16(26)6-10-24-19(29)3-4-20(24)30/h1-4H,5-14H2,(H,21,25)(H,22,26)
InChI key:InChIKey=NGTBKODKRGBWIB-UHFFFAOYSA-N
SMILES:C(CC(NCCOCCOCCNC(CCN1C(=O)C=CC1=O)=O)=O)N2C(=O)C=CC2=O
Synonyms:- Poly(oxy-1,2-ethanediyl), α-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethyl]-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]-
- α-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethyl]-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]poly(oxy-1,2-ethanediyl)
- Bis-MAL-dPEG(R)11
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Mal-PEG11-Mal
CAS:Mal-PEG11-Mal is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, Mal-PEG11-Mal is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.Formula:C38H62N4O17Purity:Min. 95%Molecular weight:846.92 g/molSPDP-dPEG®12-Acid
CAS:SPDP-dPEG®12-Acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. SPDP-dPEG®12-Acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Formula:C38H62N4O17Purity:Min. 95%Molecular weight:846.92 g/molBis-MAL-dPEG®11
CAS:Bis-MAL-dPEG®11 is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, bis-MAL-dPEG®11 is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.
Formula:C65H105F4N9O21S2Purity:Min. 95%Molecular weight:1,488.7 g/mol
