CAS 85476-90-0
:2-{4-[2-oxo-2-(piperidin-1-yl)ethyl]piperazin-1-yl}ethyl 4-[(naphthalen-1-ylacetyl)oxy]benzoate dihydrochloride
Description:
The chemical substance known as "2-{4-[2-oxo-2-(piperidin-1-yl)ethyl]piperazin-1-yl}ethyl 4-[(naphthalen-1-ylacetyl)oxy]benzoate dihydrochloride" with CAS number 85476-90-0 is a complex organic compound characterized by its multi-functional structure. It features a piperazine moiety, which is often associated with pharmacological activity, indicating potential use in medicinal chemistry. The presence of a naphthalene ring suggests aromatic characteristics, contributing to its stability and potential interactions in biological systems. The compound is a dihydrochloride salt, which typically enhances solubility in aqueous environments, making it suitable for various formulations. Its structure includes ester and ketone functional groups, which may influence its reactivity and biological interactions. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in drug development and therapeutic applications, particularly in areas related to central nervous system disorders or other pharmacological targets.
Formula:C32H39Cl2N3O5
InChI:InChI=1/C32H37N3O5.2ClH/c36-30(35-15-4-1-5-16-35)24-34-19-17-33(18-20-34)21-22-39-32(38)26-11-13-28(14-12-26)40-31(37)23-27-9-6-8-25-7-2-3-10-29(25)27;;/h2-3,6-14H,1,4-5,15-24H2;2*1H
Synonyms:- 1-Naphthaleneacetic acid, 4-((2-(4-(2-oxo-2-(1-piperidinyl)ethyl)-1-piperazinyl)ethoxy)carbonyl)phenyl ester, dihydrochloride
- FK 386
- 1-Naphthaleneacetic acid, 4-((2-(4-(2-oxo-2-(1-piperidinyl)ethyl)-1-pi perazinyl)ethoxy)carbonyl)phenyl ester, dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FK-386 HCl
CAS:FK-386 HCl is an inhibitor of chymotrypsin.Formula:C32H39Cl2N3O5Color and Shape:SolidMolecular weight:616.58
