CAS 85477-02-7

5-Bromo-2,4-dimethoxybenzenesulfonyl chloride

Description:

5-Bromo-2,4-dimethoxybenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a bromine atom and two methoxy groups attached to a benzene ring, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a useful intermediate in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. It is typically a solid at room temperature and may exhibit moderate to high solubility in organic solvents. The compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Safety precautions are essential when working with this substance due to its potential irritant properties and reactivity. Overall, 5-Bromo-2,4-dimethoxybenzenesulfonyl chloride is a valuable reagent in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₈H₈BrClO₄S

InChI: InChI=1S/C8H8BrClO4S/c1-13-6-4-7(14-2)8(3-5(6)9)15(10,11)12/h3-4H,1-2H3

InChI key: InChIKey=AHQXIQGOFUWTAS-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(OC)C=C(OC)C(Br)=C1

Synonyms:

• 5-Bromo-2,4-dimethoxybenzenesulfonylchloride
• 5-Bromo-2,4-dimethoxybenzenesulfonyl chloride
• Benzenesulfonyl chloride, 5-bromo-2,4-dimethoxy-