CAS 854778-30-6

2-Chloro-3-methoxyphenylboronic acid

Description:

2-Chloro-3-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. This compound features a chloro substituent and a methoxy group on a phenyl ring, which can influence its reactivity and solubility. Typically, boronic acids like this one are utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. The presence of the chloro and methoxy groups can enhance its reactivity and selectivity in these reactions. Additionally, the compound's boronic acid functionality allows it to participate in the formation of boronate esters, which are important intermediates in organic synthesis. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Overall, 2-Chloro-3-methoxyphenylboronic acid is a valuable reagent in the field of synthetic organic chemistry.

Formula: C₇H₈BClO₃

InChI: InChI=1S/C7H8BClO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4,10-11H,1H3

InChI key: InChIKey=ZDWONVAXOXYOJK-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(Cl)C(OC)=CC=C1

Synonyms:

• B-(2-Chloro-3-methoxyphenyl)boronic acid
• 2-Chloro-3-methoxyphenylboronic acid
• Boronic acid, (2-chloro-3-methoxyphenyl)-
• Boronic acid, B-(2-chloro-3-methoxyphenyl)-

(2-Chloro-3-methoxyphenyl)boronic acid

CAS: 854778-30-6

Formula: C₇H₈BClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.4006

Ref: IN-DA00337I

(2-Chloro-3-methoxyphenyl)boronic acid

CAS: 854778-30-6

(2-Chloro-3-methoxyphenyl)boronic acid

Purity: 97%

Molecular weight: 186.40g/mol

Ref: 54-OR350096

(2-Chloro-3-methoxyphenyl)boronic acid

CAS: 854778-30-6

Formula: C₇H₈BClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 186.4

Ref: 10-F362033