CAS 85485-61-6

1,4-dimethyl-1H-pyrazol-3-amine

Description:

1,4-Dimethyl-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which features two methyl groups at the 1 and 4 positions and an amino group at the 3 position. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure contributes to its potential reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The presence of the dimethyl groups can influence its electronic properties and steric hindrance, affecting its interactions with other molecules. Additionally, 1,4-dimethyl-1H-pyrazol-3-amine may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₉N₃

InChI: InChI=1/C5H9N3/c1-4-3-8(2)7-5(4)6/h3H,1-2H3,(H2,6,7)

SMILES: Cc1cn(C)[nH]c1=N

Synonyms:

• 1H-pyrazol-3-amine, 1,4-dimethyl-

1H-Pyrazol-3-amine,1,4-dimethyl-(9CI)

CAS: 85485-61-6

Formula: C₅H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 111.1451

Ref: IN-DA00G4YU

1,4-Dimethyl-1H-pyrazol-3-amine

CAS: 85485-61-6

1,4-Dimethyl-1H-pyrazol-3-amine

Purity: 98%

Molecular weight: 111.15g/mol

Ref: 54-OR82456

1,4-Dimethyl-1H-pyrazol-3-amine

CAS: 85485-61-6

Formula: C₅H₉N₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 111.148

Ref: 10-F457721

3-Amino-1,4-dimethylpyrazole

Controlled Product

CAS: 85485-61-6

Applications 3-Amino-1,4-dimethylpyrazole is used in the preparation of peptides as cysteine protease inhibitors.

Formula: C₅H₉N₃

Color and Shape: Neat

Molecular weight: 111.145

Ref: TR-A607430