CAS 854859-30-6
:ethyl 5-oxo-5-(2,3,4-trimethoxyphenyl)pentanoate
Description:
Ethyl 5-oxo-5-(2,3,4-trimethoxyphenyl)pentanoate is an organic compound characterized by its ester functional group, which is typical of many compounds in organic chemistry. The presence of the 5-oxo group indicates that it contains a ketone functionality, contributing to its reactivity and potential applications in synthesis. The compound features a pentanoate backbone, which is a five-carbon chain, and is substituted with a 2,3,4-trimethoxyphenyl group, suggesting that it has significant aromatic character due to the presence of multiple methoxy groups. These methoxy substituents can enhance the compound's solubility in organic solvents and may influence its biological activity. The overall structure suggests potential uses in pharmaceuticals or as intermediates in organic synthesis. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a versatile compound in synthetic organic chemistry. As with many organic compounds, its properties such as solubility, melting point, and reactivity would depend on the specific conditions and environment in which it is studied.
Formula:C16H22O6
InChI:InChI=1/C16H22O6/c1-5-22-14(18)8-6-7-12(17)11-9-10-13(19-2)16(21-4)15(11)20-3/h9-10H,5-8H2,1-4H3
SMILES:CCOC(=O)CCCC(=O)c1ccc(c(c1OC)OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.