CAS 854860-19-8
:Cinchoninic acid, 3-methoxy-2-methyl-, methyl ester
Description:
Cinchoninic acid, 3-methoxy-2-methyl-, methyl ester, with the CAS number 854860-19-8, is an organic compound derived from cinchona alkaloids. It features a methoxy group and a methyl ester functional group, contributing to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water, which is characteristic of many alkaloid derivatives. Its structure includes a bicyclic framework, which is common in cinchona derivatives, and it may exhibit biological activity, potentially influencing its use in pharmaceuticals or as a biochemical tool. The presence of the methoxy and methyl ester groups can affect its reactivity and interaction with biological systems. Additionally, like many alkaloids, it may possess chiral centers, leading to the possibility of enantiomeric forms, which can have different biological activities. Overall, cinchoninic acid methyl ester is of interest in medicinal chemistry and may be studied for its potential therapeutic applications.
Formula:C13H13NO3
InChI:InChI=1S/C13H13NO3/c1-8-12(16-2)11(13(15)17-3)9-6-4-5-7-10(9)14-8/h4-7H,1-3H3
InChI key:InChIKey=DKHMKLNHPTZUGJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(N=C(C)C1OC)C=CC=C2
Synonyms:- Cinchoninic acid, 3-methoxy-2-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
