CAS 854860-52-9
:2,5-Dichloro-3,6-dimethylbenzenesulfonyl chloride
Description:
2,5-Dichloro-3,6-dimethylbenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a benzene ring substituted with two chlorine atoms at the 2 and 5 positions, and two methyl groups at the 3 and 6 positions, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in various nucleophilic substitution reactions. It is typically used as a reagent in the synthesis of sulfonamides and other sulfonyl-containing compounds. The compound is likely to be a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures. Additionally, it may be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. Overall, 2,5-Dichloro-3,6-dimethylbenzenesulfonyl chloride is a valuable intermediate in organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H7Cl3O2S
InChI:InChI=1S/C8H7Cl3O2S/c1-4-3-6(9)5(2)8(7(4)10)14(11,12)13/h3H,1-2H3
InChI key:InChIKey=QBTUHWBMGWMUGH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(C)C(Cl)=CC(C)=C1Cl
Synonyms:- 2,5-Dichloro-3,6-dimethylbenzene-1-sulfonyl chloride
- 2,5-Xylenesulfonyl chloride, 3,6-dichloro-
- Benzenesulfonyl chloride, 2,5-dichloro-3,6-dimethyl-
- 2,5-Dichloro-3,6-dimethylbenzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.