CAS 855-91-4

N-{4-[(1-phenyl-1H-pyrazol-5-yl)sulfamoyl]phenyl}acetamide

Description:

N-{4-[(1-phenyl-1H-pyrazol-5-yl)sulfamoyl]phenyl}acetamide, with the CAS number 855-91-4, is a chemical compound that belongs to the class of sulfonamides. This substance features a complex structure that includes a phenyl group, a pyrazole moiety, and an acetamide functional group. It is characterized by its sulfonamide linkage, which contributes to its potential biological activity, particularly in medicinal chemistry. The compound may exhibit properties such as antibacterial or anti-inflammatory effects, typical of many sulfonamides. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the presence of the pyrazole ring may influence its reactivity and interaction with biological targets. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, this compound is of interest in pharmaceutical research and development due to its structural features and potential therapeutic applications.

Formula: C₁₇H₁₆N₄O₃S

InChI: InChI=1/C17H16N4O3S/c1-13(22)19-14-7-9-16(10-8-14)25(23,24)20-17-11-12-18-21(17)15-5-3-2-4-6-15/h2-12,20H,1H3,(H,19,22)

SMILES: CC(=Nc1ccc(cc1)S(=O)(=O)Nc1ccnn1c1ccccc1)O

Synonyms:

• acetamide, N-[4-[[(1-phenyl-1H-pyrazol-5-yl)amino]sulfonyl]phenyl]-