CAS 85504-42-3

5-Methylthieno[3,2-b]thiophene-3-acetic acid

Description:

5-Methylthieno[3,2-b]thiophene-3-acetic acid is an organic compound characterized by its unique thieno-thiophene structure, which incorporates both sulfur and carbon atoms in a fused ring system. This compound features a methyl group at the 5-position of the thieno ring and an acetic acid functional group at the 3-position, contributing to its potential reactivity and solubility properties. It is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. The presence of the acetic acid moiety suggests that it can participate in various chemical reactions, including esterification and amidation. Additionally, the thieno-thiophene framework is known for its applications in organic electronics, particularly in organic semiconductors and photovoltaic devices, due to its electronic properties. The compound's specific interactions, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, making it a subject of interest in both synthetic and applied chemistry.

Formula: C₉H₈O₂S₂

InChI: InChI=1S/C9H8O2S2/c1-5-2-7-9(13-5)6(4-12-7)3-8(10)11/h2,4H,3H2,1H3,(H,10,11)

InChI key: InChIKey=PLXUKOSONZDWIW-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C2=C(SC1)C=C(C)S2

Synonyms:

• 2-[5-Methylthieno[3,2-b]thiophen-3-yl]acetic acid
• Thieno[3,2-b]thiophene-3-acetic acid, 5-methyl-
• 5-Methylthieno[3,2-b]thiophene-3-acetic acid

2-{5-Methylthieno[3,2-b]thiophen-3-yl}acetic acid

CAS: 85504-42-3

Versatile small molecule scaffold

Formula: C₉H₈O₂S₂

Purity: Min. 95%

Molecular weight: 212.3 g/mol

Ref: 3D-KDA50442