CAS 85508-50-5
:2,3,7,8-tetrakis[(~37~Cl)chloro]oxanthrene
Description:
2,3,7,8-tetrakis[(~37~Cl)chloro]oxanthrene, identified by its CAS number 85508-50-5, is a chlorinated aromatic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). This substance is characterized by the presence of multiple chlorine atoms substituted at specific positions on the oxanthrene structure, which significantly influences its chemical properties, stability, and reactivity. The incorporation of chlorine atoms enhances the compound's lipophilicity, potentially affecting its environmental persistence and bioaccumulation. Additionally, the isotopic labeling with chlorine-37 may be utilized in various analytical techniques, such as mass spectrometry, to trace the compound's behavior in biological and environmental systems. The compound's unique structure may also impart specific biological activities, making it of interest in toxicological studies. Overall, 2,3,7,8-tetrakis[(~37~Cl)chloro]oxanthrene serves as a valuable model for understanding the environmental and health implications of chlorinated aromatic compounds.
Formula:C12H437Cl4O2
InChI:InChI=1/C12H4Cl4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H/i13+2,14+2,15+2,16+2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.