CAS 85514-44-9
:[(5-Chloropentyl)oxy](1,1-dimethylethyl)dimethylsilane
Description:
[(5-Chloropentyl)oxy](1,1-dimethylethyl)dimethylsilane, with the CAS number 85514-44-9, is an organosilicon compound characterized by the presence of a silane functional group. This compound features a dimethylsilane backbone, which contributes to its siloxane properties, and is substituted with a tert-butyl group and a 5-chloropentyl ether moiety. The presence of the chlorine atom introduces potential reactivity, while the pentyl chain enhances hydrophobic characteristics. The tert-butyl group provides steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound may exhibit properties such as low volatility and moderate solubility in organic solvents, making it useful in various applications, including as a coupling agent or surface modifier in materials science. Its unique structure allows for potential use in organic synthesis and as an intermediate in the production of more complex silane derivatives. Safety and handling precautions should be observed due to the presence of chlorine and the potential for reactivity.
Formula:C11H25ClOSi
InChI:InChI=1S/C11H25ClOSi/c1-11(2,3)14(4,5)13-10-8-6-7-9-12/h6-10H2,1-5H3
InChI key:InChIKey=NMBHLHINPZVQIR-UHFFFAOYSA-N
SMILES:[Si](OCCCCCCl)(C(C)(C)C)(C)C
Synonyms:- ((5-Chloropentyl)oxy)-dimethyl-tert-butylsilane
- Silane, [(5-chloropentyl)oxy](1,1-dimethylethyl)dimethyl-
- [(5-Chloropentyl)oxy](1,1-dimethylethyl)dimethylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.