
CAS 85514-94-9
:α-Ethenyl-4-methyl-3-pyridinemethanol
Description:
α-Ethenyl-4-methyl-3-pyridinemethanol, with the CAS number 85514-94-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a vinyl group (ethenyl) and a hydroxymethyl group attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 4-position of the pyridine enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The hydroxymethyl group can participate in hydrogen bonding, making the compound potentially useful in various chemical reactions, including those involving nucleophilic substitution or condensation. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, α-Ethenyl-4-methyl-3-pyridinemethanol is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C9H11NO
InChI:InChI=1S/C9H11NO/c1-3-9(11)8-6-10-5-4-7(8)2/h3-6,9,11H,1H2,2H3
InChI key:InChIKey=ATIMCBMMKCTLAM-UHFFFAOYSA-N
SMILES:C(C=C)(O)C=1C(C)=CC=NC1
Synonyms:- 3-Pyridinemethanol, α-ethenyl-4-methyl-, (±)-
- α-Ethenyl-4-methyl-3-pyridinemethanol
- 1-(4-Methylpyridin-3-yl)prop-2-en-1-ol
- 3-Pyridinemethanol, α-ethenyl-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.