CAS 855220-23-4

2-(benzhydrylamino)-1-(3,4-dibenzyloxyphenyl)butan-1-one hydrochloride

Description:

2-(Benzyhydrylamino)-1-(3,4-dibenzyloxyphenyl)butan-1-one hydrochloride is a synthetic organic compound characterized by its complex structure, which includes a butanone backbone substituted with a benzhydrylamino group and a 3,4-dibenzyloxyphenyl moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic components. The presence of the hydrochloride salt form enhances its stability and solubility in polar solvents. It may exhibit biological activity, potentially influencing various biochemical pathways, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may interact with specific receptors or enzymes, which could be explored for therapeutic applications. As with many synthetic compounds, safety and handling precautions are essential, given the potential for toxicity or adverse effects. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and development contexts.

Formula: C₃₇H₃₆ClNO₃

InChI: InChI=1/C37H35NO3.ClH/c1-2-33(38-36(30-19-11-5-12-20-30)31-21-13-6-14-22-31)37(39)32-23-24-34(40-26-28-15-7-3-8-16-28)35(25-32)41-27-29-17-9-4-10-18-29;/h3-25,33,36,38H,2,26-27H2,1H3;1H

SMILES: CCC(C(=O)c1ccc(c(c1)OCc1ccccc1)OCc1ccccc1)NC(c1ccccc1)c1ccccc1.Cl