CymitQuimica logo

CAS 855230-60-3

:

Boronic acid, B-(2-fluoro-3-hydroxyphenyl)-

Description:
Boronic acid, specifically B-(2-fluoro-3-hydroxyphenyl)-, is an organoboron compound characterized by the presence of a boron atom bonded to a phenyl group that contains both a fluorine atom and a hydroxyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's reactivity and influence its biological activity, while the hydroxyl group contributes to its solubility in polar solvents. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, this specific boronic acid may exhibit unique characteristics related to its molecular structure, such as its acidity, stability, and potential interactions with biological targets. Overall, B-(2-fluoro-3-hydroxyphenyl)- boronic acid is a versatile compound with significant implications in both synthetic and pharmaceutical chemistry.
Formula:C6H6BFO3
InChI:InChI=1S/C6H6BFO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9-11H
InChI key:FUYFURLPSFAOGC-UHFFFAOYSA-N
SMILES:B(C1=C(C(=CC=C1)O)F)(O)O
Synonyms:
  • Boronicacid, (2-fluoro-3-hydroxyphenyl)-
  • 2-Fluoro-3-hydroxyphenylboronic acid
Found 4 products.