CymitQuimica logo

CAS 855230-62-5

:

B-[2-Fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid

Description:
B-[2-Fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a fluorine atom and a trifluoroethoxy group, which enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the fluorinated substituents can impart unique electronic properties, potentially affecting the compound's biological activity and interaction with biological targets. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their importance in the development of pharmaceuticals and agrochemicals.
Formula:C8H7BF4O3
InChI:InChI=1S/C8H7BF4O3/c10-7-5(9(14)15)2-1-3-6(7)16-4-8(11,12)13/h1-3,14-15H,4H2
InChI key:InChIKey=JIMLGESDYYCOPQ-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=C(F)C(B(O)O)=CC=C1
Synonyms:
  • B-[2-Fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid
  • Boronic acid, [2-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]-
  • [2-Fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid
  • Boronic acid, B-[2-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.