CAS 855308-66-6
:4-(5-bromothiophen-2-yl)pyrimidin-2-amine
Description:
4-(5-Bromothiophen-2-yl)pyrimidin-2-amine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with an amine group and a thiophene moiety that is further brominated. This compound typically exhibits properties associated with both heterocyclic aromatic compounds and halogenated derivatives. The presence of the bromine atom can influence its reactivity and solubility, often enhancing its biological activity or interaction with other molecules. The thiophene ring contributes to the compound's electronic properties, potentially making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the amine group can participate in hydrogen bonding, affecting the compound's solubility and interaction with biological targets. Overall, 4-(5-bromothiophen-2-yl)pyrimidin-2-amine is of interest in medicinal chemistry due to its potential as a lead compound in drug development, particularly in areas targeting specific biological pathways.
Formula:C8H6BrN3S
InChI:InChI=1/C8H6BrN3S/c9-7-2-1-6(13-7)5-3-4-11-8(10)12-5/h1-4H,(H2,10,11,12)
SMILES:c1cc(Br)sc1c1cc[nH]c(=N)n1
Synonyms:- 2-Pyrimidinamine, 4-(5-bromo-2-thienyl)-
- 4-(5-Bromo-2-thienyl)-2-pyrimidinamine
- 4-(5-Bromo-2-thienyl)-2-pyrimidinylamine
- 4-(5-Bromothien-2-yl)pyrimidin-2-amine
- 855308-66-6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(5-Bromo-2-thienyl)-2-pyrimidinamine
CAS:Formula:C8H6BrN3SColor and Shape:SolidMolecular weight:256.1223

