CAS 855308-68-8
:1-[4-(2-Thienyl)-2-pyrimidinyl]-1H-pyrrole-2-carboxaldehyde
Description:
1-[4-(2-Thienyl)-2-pyrimidinyl]-1H-pyrrole-2-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyrrole ring, a pyrimidine moiety, and a thienyl group. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the thienyl and pyrimidinyl groups suggests that it may exhibit interesting electronic properties and biological activity, making it a candidate for research in drug development. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound's unique arrangement of heteroatoms may impart specific pharmacological properties, warranting further investigation into its potential therapeutic uses. Overall, 1-[4-(2-Thienyl)-2-pyrimidinyl]-1H-pyrrole-2-carboxaldehyde represents a valuable compound in the field of chemistry, particularly in the exploration of novel pharmaceuticals.
Formula:C13H9N3OS
InChI:InChI=1S/C13H9N3OS/c17-9-10-3-1-7-16(10)13-14-6-5-11(15-13)12-4-2-8-18-12/h1-9H
InChI key:InChIKey=LJYQKKGCVGQDON-UHFFFAOYSA-N
SMILES:C(=O)C=1N(C=2N=C(C=CN2)C3=CC=CS3)C=CC1
Synonyms:- 1-(4-Thiophen-2-ylpyrimidin-2-yl)pyrrole-2-carbaldehyde
- 1H-Pyrrole-2-carboxaldehyde, 1-[4-(2-thienyl)-2-pyrimidinyl]-
- 1-[4-(2-Thienyl)-2-pyrimidinyl]-1H-pyrrole-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.