CAS 85531-03-9
:6-(Bromomethyl)tridecane
Description:
6-(Bromomethyl)tridecane is an organic compound characterized by a long-chain alkane structure with a bromomethyl group attached to the sixth carbon of a tridecane backbone. Its molecular formula is C13H27Br, indicating the presence of 13 carbon atoms, 27 hydrogen atoms, and one bromine atom. This compound is typically a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature due to the long hydrocarbon chain. The bromomethyl group introduces reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of carbon-carbon bonds through nucleophilic substitution reactions. Additionally, the presence of the bromine atom can enhance the compound's reactivity in various chemical transformations, such as elimination reactions or coupling reactions. Safety precautions should be observed when handling this compound, as brominated organic compounds can be hazardous. Overall, 6-(Bromomethyl)tridecane serves as a valuable building block in the synthesis of more complex organic molecules.
Formula:C14H29Br
InChI:InChI=1S/C14H29Br/c1-3-5-7-8-10-12-14(13-15)11-9-6-4-2/h14H,3-13H2,1-2H3
InChI key:InChIKey=DDWZTZDZRNVURY-UHFFFAOYSA-N
SMILES:C(CCCCCCC)(CCCCC)CBr
Synonyms:- Tridecane, 6-(bromomethyl)-
- 6-(Bromomethyl)tridecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(Bromomethyl)tridecane
CAS:Controlled Product<p>Applications 4-(Bromomethyl)nonane can be used as both a reagent and is incorporated into anionic surfactants.<br>References Jin, Z., et al.: J. Dispersion. Sci. Technol., 32, 898-902 (2011)<br></p>Formula:C14H29BrColor and Shape:NeatMolecular weight:277.284
