CAS 85531-18-6

2-[(2-Carboxyphenoxy)carbonyl]phenyl 2-[(2-hydroxybenzoyl)oxy]benzoate

Description:

2-[(2-Carboxyphenoxy)carbonyl]phenyl 2-[(2-hydroxybenzoyl)oxy]benzoate, with CAS number 85531-18-6, is a complex organic compound characterized by its multi-functional structure. It features multiple aromatic rings, which contribute to its stability and potential for various interactions. The presence of carboxylic acid and hydroxyl groups indicates that it can engage in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit properties typical of esters and phenolic compounds, such as potential antioxidant activity and reactivity in various chemical environments. Its structural components suggest applications in fields like pharmaceuticals, where it could serve as an intermediate or active ingredient due to its bioactive characteristics. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it versatile for synthetic chemistry applications. Overall, this compound's unique structure and functional groups position it as a candidate for research in medicinal chemistry and materials science.

Formula: C₂₈H₁₈O₉

InChI: InChI=1S/C28H18O9/c29-21-13-5-1-9-17(21)26(32)36-23-15-7-3-11-19(23)28(34)37-24-16-8-4-12-20(24)27(33)35-22-14-6-2-10-18(22)25(30)31/h1-16,29H,(H,30,31)

InChI key: InChIKey=OAJWYQJJDQBHJX-UHFFFAOYSA-N

SMILES: C(OC1=C(C(O)=O)C=CC=C1)(=O)C2=C(OC(=O)C3=C(OC(=O)C4=C(O)C=CC=C4)C=CC=C3)C=CC=C2

Synonyms:

• Benzoic acid, 2-[(2-hydroxybenzoyl)oxy]-, 2-[(2-carboxyphenoxy)carbonyl]phenyl ester
• 2-[(2-Carboxyphenoxy)carbonyl]phenyl 2-[(2-hydroxybenzoyl)oxy]benzoate

Tetra-salicyclic Acid

Controlled Product

CAS: 85531-18-6

Formula: C₂₈H₁₈O₉

Color and Shape: Neat

Molecular weight: 498.437

Ref: TR-T306445