CAS 85541-42-0

Octadecanoic acid-1-13C

Description:

Octadecanoic acid-1-13C, also known as stearic acid-1-13C, is a long-chain saturated fatty acid characterized by its 18 carbon atoms and a carboxylic acid functional group. The "1-13C" designation indicates that one of the carbon atoms in the molecule is a stable isotope of carbon, specifically carbon-13, which is used in various applications such as metabolic studies and tracing in biochemical research. This compound is typically a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents. It has a high melting point due to its long hydrocarbon chain, which contributes to its solid state at ambient temperatures. Octadecanoic acid is commonly found in animal and vegetable fats and oils and is used in the production of soaps, cosmetics, and food additives. Its isotopic labeling allows for enhanced tracking in metabolic pathways, making it valuable in research settings. Overall, octadecanoic acid-1-13C serves both practical applications in industry and significant roles in scientific research.

Formula: C₁₇¹³CH₃₆O₂

InChI: InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i18+1

Synonyms:

• (1-13C)octadecanoic acid

Octadecanoic acid-1-13C

CAS: 85541-42-0

Formula: C18H36O2

Purity: >98%

Color and Shape: Solid

Molecular weight: 285.47

Ref: 48-78-1800

Stearic Acid-1-13C

CAS: 85541-42-0

Applications Stearic Acid-1-13C (cas# 85541-42-0) is a compound useful in organic synthesis.

Formula: CC₁₇H₃₆O₂

Color and Shape: Neat

Molecular weight: 285.47

Ref: TR-S686500