CAS 85541-57-7
:Benzeneacetic acid, α-methoxy-α-(trifluoromethyl)-, anhydride, (αR,α′R)-
Description:
Benzeneacetic acid, α-methoxy-α-(trifluoromethyl)-, anhydride, (αR,α′R)-, with CAS number 85541-57-7, is a chemical compound characterized by its unique structural features, including a benzene ring, a methoxy group, and a trifluoromethyl group. This compound is an anhydride, indicating that it is derived from a carboxylic acid by the removal of water, which often enhances its reactivity. The presence of the trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical applications. The specific stereochemistry denoted by (αR,α′R)- suggests that the compound has defined chiral centers, which can significantly affect its interaction with biological systems. In terms of physical properties, such compounds typically exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the presence of functional groups. Overall, this compound's unique characteristics make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C20H16F6O5
InChI:InChI=1S/C20H16F6O5/c1-29-17(19(21,22)23,13-9-5-3-6-10-13)15(27)31-16(28)18(30-2,20(24,25)26)14-11-7-4-8-12-14/h3-12H,1-2H3/t17-,18-/m1/s1
InChI key:InChIKey=AATFPUCRBIXXID-QZTJIDSGSA-N
SMILES:[C@](C(OC([C@]([C@@](F)(F)F)(OC)C1=CC=CC=C1)=O)=O)(C(F)(F)F)(OC)C2=CC=CC=C2
Synonyms:- (+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic anhydride
- Benzeneacetic acid, α-methoxy-α-(trifluoromethyl)-, anhydride, (αR,α′R)-
- Benzeneacetic acid, α-methoxy-α-(trifluoromethyl)-, anhydride, [R-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(+)-α-methoxy-α-(trifluoromethyl)phenylacetic anhydride
CAS:Formula:C18H12F6O5Molecular weight:422.2753
