CAS 855423-33-5

4-(pyrimidin-2-yloxy)benzoic acid

Description:

4-(Pyrimidin-2-yloxy)benzoic acid is an organic compound characterized by its structure, which includes a benzoic acid moiety linked to a pyrimidine ring via an ether bond. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid functional group. The presence of the pyrimidine ring may impart specific biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and amidation, and may serve as a ligand in coordination chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrimidine and benzoic acid portions, which can affect its interaction with biological targets or other chemical species. Overall, 4-(pyrimidin-2-yloxy)benzoic acid is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₁₁H₈N₂O₃

InChI: InChI=1/C11H8N2O3/c14-10(15)8-2-4-9(5-3-8)16-11-12-6-1-7-13-11/h1-7H,(H,14,15)

SMILES: c1cnc(nc1)Oc1ccc(cc1)C(=O)O

Synonyms:

• Benzoic Acid, 4-(2-Pyrimidinyloxy)-
• 4-(Pyrimidin-2-yloxy)benzoic acid

4-(Pyrimidin-2-yloxy)benzoic acid

CAS: 855423-33-5

Formula: C₁₁H₈N₂O₃

Color and Shape: Solid

Molecular weight: 216.1928

Ref: IN-DA00G2RR