
CAS 855423-46-0
:4-Chloro-1,3-dihydro-3-[(4-hydroxyphenyl)methylene]-2H-indol-2-one
Description:
4-Chloro-1,3-dihydro-3-[(4-hydroxyphenyl)methylene]-2H-indol-2-one is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a chloro substituent at the 4-position and a hydroxyphenylmethylene group, contributing to its potential biological activity. It typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many indole derivatives. The presence of the chloro and hydroxy groups may influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, compounds of this nature may exhibit various pharmacological activities, including anti-inflammatory or anticancer properties, although specific biological data would be required to confirm such effects. Overall, 4-Chloro-1,3-dihydro-3-[(4-hydroxyphenyl)methylene]-2H-indol-2-one represents a class of compounds that can be explored for their therapeutic potential in various fields of research.
Formula:C15H10ClNO2
InChI:InChI=1S/C15H10ClNO2/c16-12-2-1-3-13-14(12)11(15(19)17-13)8-9-4-6-10(18)7-5-9/h1-8,18H,(H,17,19)
InChI key:InChIKey=YGQMTJCPNCBMOM-UHFFFAOYSA-N
SMILES:C(=C1C=2C(NC1=O)=CC=CC2Cl)C3=CC=C(O)C=C3
Synonyms:- 4-Chloro-1,3-dihydro-3-[(4-hydroxyphenyl)methylene]-2H-indol-2-one
- 2H-Indol-2-one, 4-chloro-1,3-dihydro-3-[(4-hydroxyphenyl)methylene]-
- Oxindole, 4-chloro-3-p-hydroxybenzylidene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.