CAS 855470-73-4

Benzoic acid, 2,3-diamino-6-chloro-

Description:

Benzoic acid, 2,3-diamino-6-chloro- is an organic compound characterized by the presence of a benzoic acid moiety substituted with amino groups and a chlorine atom. Its structure features a benzene ring with a carboxylic acid group (-COOH) and two amino groups (-NH2) located at the 2 and 3 positions, along with a chlorine atom at the 6 position. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. The presence of these functional groups also suggests potential biological activity, making it of interest in pharmaceutical and biochemical research. Additionally, the chlorine substituent may influence the compound's reactivity and stability. As with many substituted benzoic acids, it may exhibit acid-base properties, and its behavior in various chemical reactions can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating characteristics of the amino groups.

Formula: C₇H₇ClN₂O₂

InChI: InChI=1S/C7H7ClN2O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,9-10H2,(H,11,12)

InChI key: InChIKey=CXUDIGPMKGIKPL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)C(N)=CC=C1Cl

Synonyms:

• Benzoic acid, 2,3-diamino-6-chloro-
• 2,3-Diamino-6-chlorobenzoic acid