CAS 855482-60-9

Methyl 4-bromo-2-(2-methylpropoxy)benzoate

Description:

Methyl 4-bromo-2-(2-methylpropoxy)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. The presence of a bromine atom at the para position of the aromatic ring contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The 2-(2-methylpropoxy) substituent introduces a branched alkyl chain, enhancing the compound's hydrophobic properties and potentially influencing its solubility in organic solvents. This compound is likely to exhibit moderate to low toxicity, typical of many brominated organic compounds, and may have specific applications in pharmaceuticals or agrochemicals due to its structural features. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. As with all chemical substances, proper handling and safety precautions should be observed, particularly due to the presence of bromine, which can pose environmental and health risks.

Formula: C₁₂H₁₅BrO₃

InChI: InChI=1S/C12H15BrO3/c1-8(2)7-16-11-6-9(13)4-5-10(11)12(14)15-3/h4-6,8H,7H2,1-3H3

InChI key: InChIKey=DLZYFQPIEBOUGI-UHFFFAOYSA-N

SMILES: O(CC(C)C)C1=C(C(OC)=O)C=CC(Br)=C1

Synonyms:

• Benzoic acid, 4-bromo-2-(2-methylpropoxy)-, methyl ester
• Methyl 4-bromo-2-(2-methylpropoxy)benzoate