CAS 85551-06-0
:(4R,6S)-6-[(E)-2-(4'-fluoro-3,3',5-trimethylbiphenyl-2-yl)ethenyl]-4-hydroxytetrahydro-2H-pyran-2-one
Description:
The chemical substance known as (4R,6S)-6-[(E)-2-(4'-fluoro-3,3',5-trimethylbiphenyl-2-yl)ethenyl]-4-hydroxytetrahydro-2H-pyran-2-one, with the CAS number 85551-06-0, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and includes a hydroxyl group that contributes to its reactivity and solubility in polar solvents. The presence of a fluoro-substituted biphenyl moiety indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. The (E)-alkene configuration suggests that the compound may exhibit specific geometric isomerism, which can significantly affect its chemical behavior and interactions. Overall, this compound's unique structure and functional groups make it a subject of interest in various fields, including organic synthesis and drug design.
Formula:C22H23FO3
InChI:InChI=1/C22H23FO3/c1-13-8-14(2)19(6-5-18-11-17(24)12-22(25)26-18)20(9-13)16-4-7-21(23)15(3)10-16/h4-10,17-18,24H,11-12H2,1-3H3/b6-5+/t17-,18-/m1/s1
Synonyms:- 2H-Pyran-2-one, 6-((1E)-2-(4'-fluoro-3,3',5-trimethyl(1,1'-biphenyl)-2-yl)ethenyl)tetrahydro-4-hydroxy-, (4R,6S)-rel-
- 2H-Pyran-2-one, 6-(2-(4'-fluoro-3,3',5-trimethyl(1,1'-biphenyl)-2-yl)ethenyl)tetrahydro-4-hydroxy-, (4R,6S)-
- 2H-pyran-2-one, 6-[(E)-2-(4'-fluoro-3,3',5-trimethyl[1,1'-biphenyl]-2-yl)ethenyl]tetrahydro-4-hydroxy-, (4R,6S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(4α,6β(E))-DL-6-(2-(4'-Fluoro-3,3',5-trimethyl(1,1'-biphenyl)-2-Yl)ethenyl)tetrahydro-4-hydroxy-2H-pyran-2-one
CAS:Controlled Product<p>(4alpha,6beta(E))-DL-6-(2-(4'-Fluoro-3,3',5-trimethyl(1,1'-biphenyl)-2-Yl)ethenyl)tetrahydro-4-hydroxy-2H-pyran-2-one is a pharmacological agent that binds to and inhibits the HMG CoA reductase enzyme. This enzyme plays a role in the production of cholesterol, which is used to form bile acids and steroid hormones. The ring structure of (4alpha,6beta(E))-DL-6-(2-(4'-Fluoro-3,3',5-trimethyl(1,1'-biphenyl)-2--Yl)ethenyl)tetrahydro -4hydroxy -2H pyran 2 one allows for it to bind to the active site of the reductase enzyme</p>Formula:C22H23FO3Purity:Min. 95%Molecular weight:354.41 g/mol
