CAS 85553-54-4

(3-pyridin-3-ylphenyl)methanol

Description:

(3-Pyridin-3-ylphenyl)methanol, with the CAS number 85553-54-4, is an organic compound characterized by its structure, which features a phenyl group and a pyridine ring attached to a methanol moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the hydroxyl (-OH) group. The presence of the pyridine ring may impart basicity and influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Its melting point, boiling point, and specific reactivity would depend on the molecular interactions and the environment in which it is studied. Overall, (3-pyridin-3-ylphenyl)methanol is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₂H₁₁NO

InChI: InChI=1/C12H11NO/c14-9-10-3-1-4-11(7-10)12-5-2-6-13-8-12/h1-8,14H,9H2

SMILES: c1cc(cc(c1)c1cccnc1)CO

Synonyms:

• (3-Pyrid-3-Ylphenyl)Methanol

[3-(pyridin-3-yl)phenyl]methanol

CAS: 85553-54-4

Formula: C₁₂H₁₁NO

Purity: 97%

Molecular weight: 185.2218

Ref: IN-DA008HG6

[3-(Pyridin-3-yl)phenyl]methanol

CAS: 85553-54-4

[3-(Pyridin-3-yl)phenyl]methanol

Purity: 95%

Color and Shape: Colourless Liquid

Molecular weight: 185.22g/mol

Ref: 54-OR9730

3-(Pyridin-3-yl)benzyl alcohol

CAS: 85553-54-4

Formula: C₁₂H₁₁NO

Purity: 95.0%

Molecular weight: 185.226

Ref: 10-F069926

(3-Pyrid-3-ylphenyl)methanol

CAS: 85553-54-4

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO

Purity: Min. 95%

Molecular weight: 185.22 g/mol

Ref: 3D-KDA55354