CAS 855531-18-9

ethyl 2-[(4-chlorophenyl)amino]thiazole-5-carboxylate

Description:

Ethyl 2-[(4-chlorophenyl)amino]thiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of the 4-chlorophenyl group indicates that there is a chlorine atom attached to a phenyl ring, which can influence the compound's reactivity and biological activity. The ethyl ester functional group contributes to its solubility and potential for esterification reactions. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The thiazole moiety is often associated with antimicrobial and anticancer properties, which may be relevant for its applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the thiazole and phenyl rings, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₂H₁₁ClN₂O₂S

InChI: InChI=1/C12H11ClN2O2S/c1-2-17-11(16)10-7-14-12(18-10)15-9-5-3-8(13)4-6-9/h3-7H,2H2,1H3,(H,14,15)

Synonyms:

• Ethyl 2-(4-chlorophenylamino)-5-thiazolecarboxylate
• 855531-18-9