CAS 855531-26-9

N-(4-Chloro-3-methoxyphenyl)thiourea

Description:

N-(4-Chloro-3-methoxyphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group attached to a substituted aromatic ring. The compound features a chloro group and a methoxy group on the phenyl ring, which influence its chemical reactivity and solubility. Typically, thioureas exhibit properties such as moderate to high solubility in polar solvents, and their reactivity can be attributed to the presence of the thiourea moiety, which can participate in various chemical reactions, including nucleophilic substitutions and cyclizations. The chloro and methoxy substituents can also affect the electronic properties of the aromatic ring, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. This compound may have applications in medicinal chemistry and material science, although specific uses would depend on further research into its biological activity and chemical behavior. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks.

Formula: C₈H₉ClN₂OS

InChI: InChI=1S/C8H9ClN2OS/c1-12-7-4-5(11-8(10)13)2-3-6(7)9/h2-4H,1H3,(H3,10,11,13)

InChI key: InChIKey=IWYLHPIFBFTEJN-UHFFFAOYSA-N

SMILES: N(C(N)=S)C1=CC(OC)=C(Cl)C=C1

Synonyms:

• Thiourea, N-(4-chloro-3-methoxyphenyl)-
• N-(4-Chloro-3-methoxyphenyl)thiourea
• Thiourea, (4-chloro-3-methoxyphenyl)-
• 1-(4-Chloro-3-methoxyphenyl)thiourea

(4-Chloro-3-methoxyphenyl)thiourea

CAS: 855531-26-9

Versatile small molecule scaffold

Formula: C₈H₉ClN₂OS

Purity: Min. 95%

Molecular weight: 216.69 g/mol

Ref: 3D-FJB53126