CAS 85562-55-6
:8-chloro-9-(2-deoxypentofuranosyl)-9H-purin-6-amine
Description:
8-Chloro-9-(2-deoxypentofuranosyl)-9H-purin-6-amine, with the CAS number 85562-55-6, is a purine nucleoside analog characterized by its structural components that include a purine base and a deoxypentofuranosyl sugar moiety. This compound features a chlorine atom at the 8-position of the purine ring, which can influence its biological activity and interaction with nucleic acid targets. The presence of the 2-deoxypentofuranosyl group suggests that it is a derivative of DNA, potentially impacting its incorporation into nucleic acids. This compound may exhibit antiviral or anticancer properties, as many purine analogs do, by interfering with nucleic acid synthesis or function. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As a synthetic compound, it is of interest in medicinal chemistry and pharmacology for its potential therapeutic applications. Further studies would be necessary to elucidate its specific biological effects and mechanisms of action.
Formula:C10H12ClN5O3
InChI:InChI=1/C10H12ClN5O3/c11-10-15-7-8(12)13-3-14-9(7)16(10)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,13,14)
SMILES:C1C(C(CO)OC1n1c2c(c(N)ncn2)nc1Cl)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
8-Chloro-2''-deoxyadenosine
CAS:Formula:C10H12ClN5O3Purity:≥ 98.0%Color and Shape:White or off-white powderMolecular weight:285.698-Chloro-2'-deoxyadenosine
CAS:8-Chloro-2'-deoxyadenosine is a Nucleoside Derivative - Halo-nucleoside, 8-Modified purine nucleoside.Formula:C10H12ClN5O3Color and Shape:SolidMolecular weight:285.69Ref: TM-TNU1099
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire8-Chloro-2'-deoxyadenosine
CAS:8-Chloro-2'-deoxyadenosine is a nucleoside analogue and a disinfectant that inhibits the synthesis of DNA. It has been used to control active viruses and to induce apoptotic cell death in cancer cells. 8-Chloro-2'-deoxyadenosine binds to viral RNA and DNA, preventing viral replication by inhibiting the activity of reverse transcriptase, which is an enzyme that copies the virus's genetic information from RNA into DNA. This drug has also been shown to be effective for the treatment of HIV infection. 8-Chloro-2'-deoxyadenosine disrupts DNA synthesis and cellular metabolism by blocking transcription and protein synthesis.Formula:C10H12ClN5O3Purity:Min. 95%Color and Shape:PowderMolecular weight:285.69 g/mol


