CAS 855662-12-3
:[(2S,3R,4S,5S)-4,5-dibenzoyloxy-6-bromo-2-methyl-tetrahydropyran-3-yl] benzoate
Description:
The chemical substance with the name "[(2S,3R,4S,5S)-4,5-dibenzoyloxy-6-bromo-2-methyl-tetrahydropyran-3-yl] benzoate" and CAS number "855662-12-3" is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including dibenzoyloxy groups and a bromo substituent, which contribute to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (2S,3R,4S,5S) configuration suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. The presence of the benzoate moiety indicates that it may exhibit properties typical of esters, such as solubility in organic solvents and potential for hydrolysis. Overall, this compound's unique structural features make it of interest in fields such as medicinal chemistry and materials science, where its properties can be exploited for various applications.
Formula:C27H23BrO7
InChI:InChI=1/C27H23BrO7/c1-17-21(33-25(29)18-11-5-2-6-12-18)22(34-26(30)19-13-7-3-8-14-19)23(24(28)32-17)35-27(31)20-15-9-4-10-16-20/h2-17,21-24H,1H3/t17-,21+,22-,23-,24?/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4-Tri-O-benzoyl-L-fucopyranosyl bromide
CAS:2,3,4-Tri-O-benzoyl-L-fucopyranosyl bromide is a synthetic compound that is used as a reagent in the synthesis of complex carbohydrates. It is also an intermediate in the synthesis of oligosaccharides and polysaccharides. This product can be modified by methylation, glycosylation and fluorination to generate desired products. The CAS number for this product is 855662-12-3.Formula:C27H23BrO7Purity:Min. 95%Molecular weight:539.37 g/mol

