CAS 855715-20-7

Ethyl 5-[(2-chloroacetyl)amino]-4-cyano-2-methyl-3-furancarboxylate

Description:

Ethyl 5-[(2-chloroacetyl)amino]-4-cyano-2-methyl-3-furancarboxylate is a synthetic organic compound characterized by its complex structure, which includes a furan ring, cyano group, and an ethyl ester functional group. This compound features a chloroacetyl group that contributes to its reactivity and potential biological activity. The presence of the cyano group indicates that it may participate in nucleophilic reactions, while the furan moiety is known for its aromatic properties and potential applications in pharmaceuticals. The ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions and applications. Additionally, the compound's unique combination of functional groups suggests potential uses in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the diversity of synthetic organic chemistry and its applications in drug discovery and development.

Formula: C₁₁H₁₁ClN₂O₄

InChI: InChI=1S/C11H11ClN2O4/c1-3-17-11(16)9-6(2)18-10(7(9)5-13)14-8(15)4-12/h3-4H2,1-2H3,(H,14,15)

InChI key: InChIKey=MWYDQBJAHBXQQZ-UHFFFAOYSA-N

SMILES: C(#N)C1=C(NC(CCl)=O)OC(C)=C1C(OCC)=O

Synonyms:

• 3-Furancarboxylic acid, 5-[(chloroacetyl)amino]-4-cyano-2-methyl-, ethyl ester
• 3-Furancarboxylic acid, 5-[(2-chloroacetyl)amino]-4-cyano-2-methyl-, ethyl ester
• Ethyl 5-[(2-chloroacetyl)amino]-4-cyano-2-methyl-3-furancarboxylate