CAS 855715-27-4

3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid

Description:

3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid is a heterocyclic compound characterized by its unique thieno and pyrazole ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the methyl and isobutyl substituents enhances its lipophilicity, potentially influencing its solubility and biological activity. The thieno[2,3-c]pyrazole framework is known for its diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its interaction with biological targets. Overall, 3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid represents a complex and potentially valuable chemical entity in research and development.

Formula: C₁₁H₁₄N₂O₂S

InChI: InChI=1S/C11H14N2O2S/c1-6(2)5-13-10-8(7(3)12-13)4-9(16-10)11(14)15/h4,6H,5H2,1-3H3,(H,14,15)

InChI key: InChIKey=HCMVRUJVLRJVQQ-UHFFFAOYSA-N

SMILES: C(C(C)C)N1C2=C(C=C(C(O)=O)S2)C(C)=N1

Synonyms:

• 1H-Thieno[2,3-c]pyrazole-5-carboxylic acid, 3-methyl-1-(2-methylpropyl)-
• 3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid