
CAS 855715-27-4
:3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid
Description:
3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid is a heterocyclic compound characterized by its unique thieno and pyrazole ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the methyl and isobutyl substituents enhances its lipophilicity, potentially influencing its solubility and biological activity. The thieno[2,3-c]pyrazole framework is known for its diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its interaction with biological targets. Overall, 3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid represents a complex and potentially valuable chemical entity in research and development.
Formula:C11H14N2O2S
InChI:InChI=1S/C11H14N2O2S/c1-6(2)5-13-10-8(7(3)12-13)4-9(16-10)11(14)15/h4,6H,5H2,1-3H3,(H,14,15)
InChI key:InChIKey=HCMVRUJVLRJVQQ-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C2=C(C=C(C(O)=O)S2)C(C)=N1
Synonyms:- 1H-Thieno[2,3-c]pyrazole-5-carboxylic acid, 3-methyl-1-(2-methylpropyl)-
- 3-Methyl-1-(2-methylpropyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.