CymitQuimica logo

CAS 855715-33-2

:

2-(2-Methoxyphenyl)-1-(4-methylphenyl)-6-oxo-3-piperidinecarboxylic acid

Description:
2-(2-Methoxyphenyl)-1-(4-methylphenyl)-6-oxo-3-piperidinecarboxylic acid, with CAS number 855715-33-2, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and multiple aromatic substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the methoxy and methyl groups contributes to its lipophilicity, potentially influencing its biological activity and interaction with various biological targets. The oxo group in the structure suggests the potential for reactivity, particularly in forming derivatives or participating in further chemical reactions. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, although specific biological activities would require empirical investigation. As with many synthetic compounds, safety data and handling precautions should be considered, as they can vary based on the compound's specific characteristics and intended use.
Formula:C20H21NO4
InChI:InChI=1S/C20H21NO4/c1-13-7-9-14(10-8-13)21-18(22)12-11-16(20(23)24)19(21)15-5-3-4-6-17(15)25-2/h3-10,16,19H,11-12H2,1-2H3,(H,23,24)
InChI key:InChIKey=MSAZOYMMVYAYHB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(N(C(=O)CC1)C2=CC=C(C)C=C2)C3=C(OC)C=CC=C3
Synonyms:
  • 3-Piperidinecarboxylic acid, 2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxo-
  • 2-(2-Methoxyphenyl)-1-(4-methylphenyl)-6-oxo-3-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.